Guibourtinidol
Chemical structure of guibourtinidol
|
| Names
|
| IUPAC name
(2R,3S)-Flavan-3,4′,7-triol
|
Systematic IUPAC name
(2R,3S)-2-(4-Hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-2,7-diol
|
| Identifiers
|
|
|
|
| ChemSpider
|
|
|
|
|
|
|
|
InChI=1S/C15H14O4/c16-11-4-1-9(2-5-11)15-13(18)7-10-3-6-12(17)8-14(10)19-15/h1-6,8,13,15-18H,7H2/t13-,15+/m0/s1 Key: RHYGXRGFSFQNLC-DZGCQCFKSA-N InChI=1/C15H14O4/c16-11-4-1-9(2-5-11)15-13(18)7-10-3-6-12(17)8-14(10)19-15/h1-6,8,13,15-18H,7H2/t13-,15+/m0/s1 Key: RHYGXRGFSFQNLC-DZGCQCFKBZ
|
Oc1ccc(cc1)[C@H]3Oc2cc(O)ccc2C[C@@H]3O
|
| Properties
|
|
|
C15H14O4
|
| Molar mass
|
258.27 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Guibourtinidol is a flavan-3-ol. It can be found in the heartwood of Cassia abbreviata.[1]
References
- ^ Nel, Reinier J. J.; Mthembu, Makhosazana; Coetzee, Johan; van Rensburg, Hendrik; Malan, Elfranco; Ferreira, Daneel (November 1999). "The novel Flavan-3-ol, (2R,3S)-guibourtinidol and its diastereomers". Phytochemistry. 52 (6): 1153–1158. doi:10.1016/S0031-9422(99)00348-9.
|
|---|
| Flavan-3-ols | |
|---|
| O-methylated flavan-3ols |
- Meciadanol (3-O-methylcatechin)
- Ourateacatechin (4′-O-methyl-(−)-epigallocatechin)
|
|---|
| Glycosides |
- Arthromerin A (Afzelechin-3-O-β-D-xylopyranoside)
- Arthromerin B (Afzelechin-3-O-β-D-glucopyranoside)
- Catechin-3-O-glucoside
- Catechin-3'-O-glucoside
- Catechin-4'-O-glucoside
- Catechin-5-O-glucoside
- Catechin-7-O-glucoside
- (+)-Catechin 7-O-β-D-xylopyranoside
- Epicatechin-3′-O-glucoside
- Glochiflavanoside A, B, C D
- Polydine ((+)-catechin 7-O-α-L-arabinoside)
- Symplocoside (3'-O-methyl-(-)-epicatechin 7-O-β-D-glucopyranoside)
|
|---|
| Acetylated | |
|---|
| Gallate esters | |
|---|
| Misc. | |
|---|