Kaempferide
|  Kaempferide structure | 
| Names | 
| IUPAC name 3,5,7-Trihydroxy-4′-methoxyflavone | 
| Systematic IUPAC name 3,5,7-Trihydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one | 
| Other names Kaempferid4′-Methylkaempferol
 Kaempferol 4′-methyl ether
 4′-O-Methylkaempferol
 | 
| Identifiers | 
|  |  | 
|  |  | 
| ChEBI |  | 
| ChEMBL |  | 
| ChemSpider |  | 
| ECHA InfoCard | 100.007.036 | 
| KEGG |  | 
|  |  | 
| UNII |  | 
|  |  | 
| 
InChI=1S/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3  NKey: SQFSKOYWJBQGKQ-UHFFFAOYSA-N  NInChI=1/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 Key: SQFSKOYWJBQGKQ-UHFFFAOYAC
 | 
| 
COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OCOC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O
 | 
| Properties | 
|  | C16H12O6 | 
| Molar mass | 300.26 g/mol | 
| Except where otherwise noted, data are given for materials in their standard state  (at 25 °C [77 °F], 100 kPa).Infobox references | 
Kaempferide is an O-methylated flavonol, a type of chemical compound. It can be found in Kaempferia galanga (aromatic ginger). It has been noted to inhibit pancreatic cancer growth by blockading an EGFR-related pathway.[1]
The enzyme kaempferol 4'-O-methyltransferase uses S-adenosyl-L-methionine and kaempferol to produce S-adenosyl-L-homocysteine and kaempferide.
Glycosides
Icariin is the tert-amyl alcohol derivative of kaempferide 3,7-O-diglycoside.
References
External links
| Flavonols and their conjugates | 
|---|
| Backbone |  | 
|---|
| Flavonols | | Aglycones |  | 
|---|
 | Conjugates | | Glycosides of herbacetin |  | 
|---|
 | Glycosides of kaempferol | 
Afzelin (Kaempferol 3-rhamnoside)Astragalin (kaempferol 3-O-glucoside)Kaempferitrin (kaempferol 3,7-dirhamnoside)Juglanin (Kaempferol 3-O-arabinoside)Kaempferol 3-alpha-L-arabinopyranosideKaempferol 3-alpha-D-arabinopyranosideKaempferol 7-alpha-L-arabinosideKaempferol 7-O-glucosideKaempferol 3-lathyrosideKaempferol 4'-rhamnosideKaempferol 5-rhamnosideKaempferol 7-rhamnosideKaempferol 7-O-alpha-L-rhamnofuranosideKaempferol 3-xylosideKaempferol 7-xylosideRobinin (kaempferol-3-O-robinoside-7-O-rhamnoside)Kaempferol 3-O-rutinosideSophoraflavonoloside (Kaempferol 3-O-sophoroside)Trifolin (Kaempferol 3-O-beta-D-galactoside)
 | 
|---|
 | Glycosides of myricetin |  | 
|---|
 | Conjugates of quercetin |  | 
|---|
 | 
|---|
 | 
|---|
| O-Methylated flavonols | | Aglycones |  | 
|---|
 | Glycosides | | of isorhamnetin | 
Narcissin (Isorhamnetin 3-O-rutinoside)Isorhamnetin 3-O-glucosideTamarixetin 7-rutinoside
 | 
|---|
 | other | 
Azalein (Azaleatin 3-O-α-L-rhamnoside)Centaurein (Centaureidin 7-O-glucoside)Eupalin (Eupalitin 3-0-rhamnoside)Eupatolin (Eupatolitin 3-O-rhamnoside)Jacein (Jaceidin 7-O-glucoside)Patulitrin (Patuletin 7-O-glucosideXanthorhamnin (Rhamnetin glycoside)
 | 
|---|
 | 
|---|
 | 
|---|
| Derivative flavonols | | Aglycones | 
NoricaritinDihydronoricaritin
 | 
|---|
 | Glycosides |  | 
|---|
 | 
|---|
| Pyranoflavonols |  | 
|---|
| Furanoflavonols |  | 
|---|
| Semisynthetic |  | 
|---|