Phenylalanine (data page)
| The complete data for Phenylalanine () | ||||||||||||||||
|    | General information Chemical formula: C9H11NO2  Molar mass: 165.19 g·mol−1 Systematic name: 2-Amino-3-phenyl-propanoic acid Abbreviations: F, Phe Synonyms: alpha-Amino-beta-phenylpropionic acid (2R)-2-amino-3- phenylpropanoic acid (2S)-2-amino-3-phenylpropanoic acid | |||||||||||||||
| Database data | ||||||||||||||||
| SMILES: C1=CC=C(C=C1)CC(C(=O)O)N InChI=1/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/f/h11H 
 | ||||||||||||||||
| Physical properties | ||||||||||||||||
| 
 
 | ||||||||||||||||
| Hazard properties | ||||||||||||||||
| 
 | ||||||||||||||||
| Chemical properties | ||||||||||||||||
| 
 | ||||||||||||||||
| Pharmacological properties | ||||||||||||||||
  This box:   
- Except where noted otherwise, data relate to Standard temperature and pressure.
- Reliability of data general note.
