RCS-8 |
|
| Legal status |
|
|---|
|
2-(2-Methoxyphenyl)-1-[1-(2-cyclohexylethyl)indol-3-yl]ethanone
|
| CAS Number | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C25H29NO2 |
|---|
| Molar mass | 375.512 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
COc1ccccc1CC(=O)c2cn(c3c2cccc3)CCC4CCCCC4
|
InChI=1S/C25H29NO2/c1-28-25-14-8-5-11-20(25)17-24(27)22-18-26(23-13-7-6-12-21(22)23)16-15-19-9-3-2-4-10-19/h5-8,11-14,18-19H,2-4,9-10,15-17H2,1H3 YKey:BSQFBMXCQIKYNI-UHFFFAOYSA-N Y
|
N Y (what is this?) (verify) |
RCS-8 (also known as 1-(2-cyclohexylethyl)-3-(2-methoxyphenylacetyl)indole, SR-18, and BTM-8) is a synthetic cannabinoid that has been found as an ingredient of "herbal smoking blends". It can be described as an analogue of JWH-250 with the 1-pentyl group replaced by 1-(2-cyclohexylethyl), and can be expected to be less potent than JWH-250.[1] All CB1 receptor agonists of the 3-phenylacetylindole class such as RCS-8 are Schedule I Controlled Substances within the United States.[2]
See also
References
- ^ Huffman JW, Dai D, Martin BR, Compton DR (1994). "Design, Synthesis and Pharmacology of Cannabimimetic Indoles". Bioorganic & Medicinal Chemistry Letters. 4 (4): 563–566. doi:10.1016/S0960-894X(01)80155-4.
- ^ 21 U.S.C. § 812: Schedules of controlled substances
|
|---|
Phytocannabinoids (comparison) | | Cannabibutols | |
|---|
| Cannabichromenes | |
|---|
| Cannabicyclols | |
|---|
| Cannabidiols | |
|---|
| Cannabielsoins | |
|---|
| Cannabigerols | |
|---|
| Cannabiphorols | |
|---|
| Cannabinols |
- CBN
- CBNA
- CBN-C1
- CBN-C2
- CBN-C4
- CBNM
- CBND
- CBNP
- CBVD
|
|---|
| Cannabitriols | |
|---|
| Cannabivarins | |
|---|
| Delta-3-tetrahydrocannabinols | |
|---|
| Delta-4-tetrahydrocannabinols | |
|---|
| Delta-7-tetrahydrocannabinols | |
|---|
| Delta-8-tetrahydrocannabinols | |
|---|
| Delta-9-tetrahydrocannabinols | |
|---|
| Delta-10-Tetrahydrocannabinols | |
|---|
| Delta-11-Tetrahydrocannabinols | |
|---|
| Miscellaneous cannabinoids | |
|---|
| Active metabolites | |
|---|
|
|---|
| Endocannabinoids | |
|---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
|---|
Non-classical cannabinoids | |
|---|
| Adamantoylindoles | |
|---|
| Benzimidazoles | |
|---|
| Benzoylindoles | |
|---|
| Cyclohexylphenols | |
|---|
| Eicosanoids | |
|---|
Indazole-3- carboxamides | |
|---|
| Indole-3-carboxamides | |
|---|
| Indole-3-carboxylates | |
|---|
| Naphthoylindazoles | |
|---|
| Naphthoylindoles | |
|---|
| Naphthoylpyrroles | |
|---|
| Naphthylmethylindenes | |
|---|
| Naphthylmethylindoles | |
|---|
| Phenylacetylindoles | |
|---|
| Pyrazolecarboxamides | |
|---|
Tetramethylcyclo- propanoylindazoles | |
|---|
Tetramethylcyclo- propanoylindoles | |
|---|
| Others | |
|---|
|
|---|
| Allosteric CBRTooltip Cannabinoid receptor ligands | |
|---|
Endocannabinoid enhancers (inactivation inhibitors) | |
|---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
|---|
|