Serine (data page)
| The complete data for Serine () | ||||||||||||||||
|    | General information Chemical formula: C3H7NO3  Molar mass: 105.09 g·mol−1 Systematic name: -2-amino-3-hydroxypropanoic acid Abbreviations: S, Ser Synonyms: none | |||||||||||||||
| Database data | ||||||||||||||||
| SMILES: OCC(N)C(=O)O InChI=1/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/f/h6H 
 | ||||||||||||||||
| Physical properties | ||||||||||||||||
| 
 
 | ||||||||||||||||
| Hazard properties | ||||||||||||||||
| 
 | ||||||||||||||||
| Chemical properties | ||||||||||||||||
| 
 | ||||||||||||||||
| Pharmacological properties | ||||||||||||||||
  This box:   
- Except where noted otherwise, data relate to Standard temperature and pressure.
- Reliability of data general note.
